About 5-nitrothiophen-2-amine;hydrochloride
5-nitrothiophen-2-amine;hydrochloride (PubChem CID 115008612) has the molecular formula C4H5ClN2O2S
and a molecular weight of 180.62 g/mol. Its IUPAC name is 5-nitrothiophen-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-nitrothiophen-2-amine;hydrochloride |
| PubChem CID | 115008612 |
| Molecular Formula | C4H5ClN2O2S |
| Molecular Weight | 180.62 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | 5-nitrothiophen-2-amine;hydrochloride |
| SMILES | Cl.Nc1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C4H4N2O2S.ClH/c5-3-1-2-4(9-3)6(7)8;/h1-2H,5H2;1H |
| InChIKey | OHKMNZSYZDGNCM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.62 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrothiophen-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrothiophen-2-amine;hydrochloride?
The IUPAC name of 5-nitrothiophen-2-amine;hydrochloride (CID 115008612) is 5-nitrothiophen-2-amine;hydrochloride.
What is the SMILES notation for 5-nitrothiophen-2-amine;hydrochloride?
The canonical SMILES for 5-nitrothiophen-2-amine;hydrochloride is Cl.Nc1ccc([N+](=O)[O-])s1.
What is the InChIKey of 5-nitrothiophen-2-amine;hydrochloride?
The InChIKey is OHKMNZSYZDGNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S.ClH/c5-3-1-2-4(9-3)6(7)8;/h1-2H,5H2;1H.
What are the key properties of 5-nitrothiophen-2-amine;hydrochloride?
5-nitrothiophen-2-amine;hydrochloride has a molecular weight of 180.62 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrothiophen-2-amine;hydrochloride is sourced from PubChem (CID 115008612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).