About 5-nitrothiophene-2-sulfonic acid;hydrochloride
5-nitrothiophene-2-sulfonic acid;hydrochloride (PubChem CID 174905083) has the molecular formula C4H4ClNO5S2
and a molecular weight of 245.66 g/mol. Its IUPAC name is 5-nitrothiophene-2-sulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-nitrothiophene-2-sulfonic acid;hydrochloride |
| PubChem CID | 174905083 |
| Molecular Formula | C4H4ClNO5S2 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 244.92 |
| IUPAC Name | 5-nitrothiophene-2-sulfonic acid;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(S(=O)(=O)O)s1 |
| InChI | InChI=1S/C4H3NO5S2.ClH/c6-5(7)3-1-2-4(11-3)12(8,9)10;/h1-2H,(H,8,9,10);1H |
| InChIKey | QGJITBKBSBJVEE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrothiophene-2-sulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrothiophene-2-sulfonic acid;hydrochloride?
The IUPAC name of 5-nitrothiophene-2-sulfonic acid;hydrochloride (CID 174905083) is 5-nitrothiophene-2-sulfonic acid;hydrochloride.
What is the SMILES notation for 5-nitrothiophene-2-sulfonic acid;hydrochloride?
The canonical SMILES for 5-nitrothiophene-2-sulfonic acid;hydrochloride is Cl.O=[N+]([O-])c1ccc(S(=O)(=O)O)s1.
What is the InChIKey of 5-nitrothiophene-2-sulfonic acid;hydrochloride?
The InChIKey is QGJITBKBSBJVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO5S2.ClH/c6-5(7)3-1-2-4(11-3)12(8,9)10;/h1-2H,(H,8,9,10);1H.
What are the key properties of 5-nitrothiophene-2-sulfonic acid;hydrochloride?
5-nitrothiophene-2-sulfonic acid;hydrochloride has a molecular weight of 245.66 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrothiophene-2-sulfonic acid;hydrochloride is sourced from PubChem (CID 174905083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).