C11H16N2O6S2 — CID 120660458
4-methyl-2-[[(5-nitrothiophen-2-yl)sulfonylamino]methyl]pentanoic acid (PubChem CID 120660458) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-methyl-2-[[(5-nitrothiophen-2-yl)sulfonylamino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[(5-nitrothiophen-2-yl)sulfonylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 120660458 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-methyl-2-[[(5-nitrothiophen-2-yl)sulfonylamino]methyl]pentanoic acid |
| SMILES | CC(C)CC(CNS(=O)(=O)c1ccc([N+](=O)[O-])s1)C(=O)O |
| InChI | InChI=1S/C11H16N2O6S2/c1-7(2)5-8(11(14)15)6-12-21(18,19)10-4-3-9(20-10)13(16)17/h3-4,7-8,12H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | KCCFRCGHVOKQFT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|