C6H7ClF2N2O2S — CID 171251968
(1R)-2,2-difluoro-1-(5-nitrothiophen-2-yl)ethanamine;hydrochloride (PubChem CID 171251968) has the molecular formula C6H7ClF2N2O2S and a molecular weight of 244.65 g/mol. Its IUPAC name is (1R)-2,2-difluoro-1-(5-nitrothiophen-2-yl)ethanamine;hydrochloride.
| Compound Name | (1R)-2,2-difluoro-1-(5-nitrothiophen-2-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171251968 |
| Molecular Formula | C6H7ClF2N2O2S |
| Molecular Weight | 244.65 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | (1R)-2,2-difluoro-1-(5-nitrothiophen-2-yl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc([N+](=O)[O-])s1)C(F)F |
| InChI | InChI=1S/C6H6F2N2O2S.ClH/c7-6(8)5(9)3-1-2-4(13-3)10(11)12;/h1-2,5-6H,9H2;1H/t5-;/m0./s1 |
| InChIKey | HKPFSKUKZYUSET-JEDNCBNOSA-N |
| XLogP | 2.34 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|