C34H29N5Si — CID 102158110
8-[4-(dimethylamino)phenyl]-6-[2-[4-(dimethylamino)phenyl]ethynyl]-5-(2-trimethylsilylethynyl)octa-1,5-dien-3,7-diyne-1,1,2-tricarbonitrile (PubChem CID 102158110) has the molecular formula C34H29N5Si and a molecular weight of 535.73 g/mol. Its IUPAC name is 8-[4-(dimethylamino)phenyl]-6-[2-[4-(dimethylamino)phenyl]ethynyl]-5-(2-trimethylsilylethynyl)octa-1,5-dien-3,7-diyne-1,1,2-tricarbonitrile.
| Compound Name | 8-[4-(dimethylamino)phenyl]-6-[2-[4-(dimethylamino)phenyl]ethynyl]-5-(2-trimethylsilylethynyl)octa-1,5-dien-3,7-diyne-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 102158110 |
| Molecular Formula | C34H29N5Si |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 8-[4-(dimethylamino)phenyl]-6-[2-[4-(dimethylamino)phenyl]ethynyl]-5-(2-trimethylsilylethynyl)octa-1,5-dien-3,7-diyne-1,1,2-tricarbonitrile |
| SMILES | CN(C)c1ccc(C#CC(C#Cc2ccc(N(C)C)cc2)=C(C#CC(C#N)=C(C#N)C#N)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C34H29N5Si/c1-38(2)33-18-10-27(11-19-33)8-14-29(15-9-28-12-20-34(21-13-28)39(3)4)30(22-23-40(5,6)7)16-17-31(24-35)32(25-36)26-37/h10-13,18-21H,1-7H3 |
| InChIKey | YRCSLYIEXMUBET-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|