C18H11N3 — CID 54769859
2-[7-[4-(dimethylamino)phenyl]hepta-2,4,6-triynylidene]propanedinitrile (PubChem CID 54769859) has the molecular formula C18H11N3 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[7-[4-(dimethylamino)phenyl]hepta-2,4,6-triynylidene]propanedinitrile.
| Compound Name | 2-[7-[4-(dimethylamino)phenyl]hepta-2,4,6-triynylidene]propanedinitrile |
|---|---|
| PubChem CID | 54769859 |
| Molecular Formula | C18H11N3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[7-[4-(dimethylamino)phenyl]hepta-2,4,6-triynylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C#CC#CC#CC=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C18H11N3/c1-21(2)18-12-10-16(11-13-18)8-6-4-3-5-7-9-17(14-19)15-20/h9-13H,1-2H3 |
| InChIKey | PHEVCDGKWCDIAG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|