C32H24N6 — CID 24746181
2-[1-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,4-bis[4-(dimethylamino)phenyl]but-3-yn-2-ylidene]propanedinitrile (PubChem CID 24746181) has the molecular formula C32H24N6 and a molecular weight of 492.59 g/mol. Its IUPAC name is 2-[1-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,4-bis[4-(dimethylamino)phenyl]but-3-yn-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,4-bis[4-(dimethylamino)phenyl]but-3-yn-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 24746181 |
| Molecular Formula | C32H24N6 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 2-[1-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]-1,4-bis[4-(dimethylamino)phenyl]but-3-yn-2-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C#CC(=C(C#N)C#N)C(c2ccc(N(C)C)cc2)=c2ccc(=C(C#N)C#N)cc2)cc1 |
| InChI | InChI=1S/C32H24N6/c1-37(2)29-14-5-23(6-15-29)7-18-31(28(21-35)22-36)32(26-12-16-30(17-13-26)38(3)4)25-10-8-24(9-11-25)27(19-33)20-34/h5-6,8-17H,1-4H3 |
| InChIKey | QJNMHFYPLJZOQX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|