C27H10F4N8 — CID 102424310
3-[[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]buta-1,3-diene-1,1,2,4,4-pentacarbonitrile (PubChem CID 102424310) has the molecular formula C27H10F4N8 and a molecular weight of 522.43 g/mol. Its IUPAC name is 3-[[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]buta-1,3-diene-1,1,2,4,4-pentacarbonitrile.
| Compound Name | 3-[[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]buta-1,3-diene-1,1,2,4,4-pentacarbonitrile |
|---|---|
| PubChem CID | 102424310 |
| Molecular Formula | C27H10F4N8 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 3-[[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]buta-1,3-diene-1,1,2,4,4-pentacarbonitrile |
| SMILES | CN(C)c1ccc(C(C(=C(C#N)C#N)C(C#N)=C(C#N)C#N)=c2c(F)c(F)c(=C(C#N)C#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H10F4N8/c1-39(2)18-5-3-14(4-6-18)21(20(16(9-34)10-35)19(13-38)15(7-32)8-33)23-26(30)24(28)22(17(11-36)12-37)25(29)27(23)31/h3-6H,1-2H3 |
| InChIKey | YSOUFQJNWMZZIC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 169.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|