C24H20N4O — CID 102423660
2-[3-cyano-4-[4-[4-(dimethylamino)phenyl]phenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 102423660) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[3-cyano-4-[4-[4-(dimethylamino)phenyl]phenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[4-[4-(dimethylamino)phenyl]phenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102423660 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[3-cyano-4-[4-[4-(dimethylamino)phenyl]phenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(-c2ccc(C3=C(C#N)C(=C(C#N)C#N)OC3(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H20N4O/c1-24(2)22(21(15-27)23(29-24)19(13-25)14-26)18-7-5-16(6-8-18)17-9-11-20(12-10-17)28(3)4/h5-12H,1-4H3 |
| InChIKey | DCNBEWDLOSKEHY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 83.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|