C22H26N5O+ — CID 102327085
2-[4-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]-N-methylanilino]ethyl-trimethylazanium (PubChem CID 102327085) has the molecular formula C22H26N5O+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[4-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]-N-methylanilino]ethyl-trimethylazanium.
| Compound Name | 2-[4-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]-N-methylanilino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 102327085 |
| Molecular Formula | C22H26N5O+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-[4-[4-cyano-5-(dicyanomethylidene)-2,2-dimethylfuran-3-yl]-N-methylanilino]ethyl-trimethylazanium |
| SMILES | CN(CC[N+](C)(C)C)c1ccc(C2=C(C#N)C(=C(C#N)C#N)OC2(C)C)cc1 |
| InChI | InChI=1S/C22H26N5O/c1-22(2)20(19(15-25)21(28-22)17(13-23)14-24)16-7-9-18(10-8-16)26(3)11-12-27(4,5)6/h7-10H,11-12H2,1-6H3/q+1 |
| InChIKey | FJBJJFBJEGXDHT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|