C21H22N4O4S2 — CID 91385264
4-cyano-5-(dicyanomethylidene)-3-[4-(diethylamino)phenyl]-2-methyl-2-(methylsulfanylsulfonyloxymethyl)furan (PubChem CID 91385264) has the molecular formula C21H22N4O4S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-cyano-5-(dicyanomethylidene)-3-[4-(diethylamino)phenyl]-2-methyl-2-(methylsulfanylsulfonyloxymethyl)furan.
| Compound Name | 4-cyano-5-(dicyanomethylidene)-3-[4-(diethylamino)phenyl]-2-methyl-2-(methylsulfanylsulfonyloxymethyl)furan |
|---|---|
| PubChem CID | 91385264 |
| Molecular Formula | C21H22N4O4S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 4-cyano-5-(dicyanomethylidene)-3-[4-(diethylamino)phenyl]-2-methyl-2-(methylsulfanylsulfonyloxymethyl)furan |
| SMILES | CCN(CC)c1ccc(C2=C(C#N)C(=C(C#N)C#N)OC2(C)COS(=O)(=O)SC)cc1 |
| InChI | InChI=1S/C21H22N4O4S2/c1-5-25(6-2)17-9-7-15(8-10-17)19-18(13-24)20(16(11-22)12-23)29-21(19,3)14-28-31(26,27)30-4/h7-10H,5-6,14H2,1-4H3 |
| InChIKey | UUDDGAWUAVYKBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 127.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|