C30H22N4O — CID 72753310
2-[3-cyano-5,5-dimethyl-4-[2-[4-(N-phenylanilino)phenyl]ethenyl]furan-2-ylidene]propanedinitrile (PubChem CID 72753310) has the molecular formula C30H22N4O and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[3-cyano-5,5-dimethyl-4-[2-[4-(N-phenylanilino)phenyl]ethenyl]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-5,5-dimethyl-4-[2-[4-(N-phenylanilino)phenyl]ethenyl]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 72753310 |
| Molecular Formula | C30H22N4O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[3-cyano-5,5-dimethyl-4-[2-[4-(N-phenylanilino)phenyl]ethenyl]furan-2-ylidene]propanedinitrile |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1C=Cc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22N4O/c1-30(2)28(27(21-33)29(35-30)23(19-31)20-32)18-15-22-13-16-26(17-14-22)34(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-18H,1-2H3 |
| InChIKey | AJCOFSGQYILSOV-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 83.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|