C30H32N4O — CID 102145543
2-[3-cyano-4-[(E)-2-[4-(dibutylamino)naphthalen-1-yl]ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 102145543) has the molecular formula C30H32N4O and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)naphthalen-1-yl]ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)naphthalen-1-yl]ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102145543 |
| Molecular Formula | C30H32N4O |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)naphthalen-1-yl]ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/C2=C(C#N)C(=C(C#N)C#N)OC2(C)C)c2ccccc12 |
| InChI | InChI=1S/C30H32N4O/c1-5-7-17-34(18-8-6-2)28-16-14-22(24-11-9-10-12-25(24)28)13-15-27-26(21-33)29(23(19-31)20-32)35-30(27,3)4/h9-16H,5-8,17-18H2,1-4H3/b15-13+ |
| InChIKey | UFBZIXVCRJUIQC-FYWRMAATSA-N |
| XLogP | 7.19 |
| TPSA | 83.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|