C34H48N4O — CID 173170969
2-[3-cyano-5,5-dimethyl-4-(2-phenylethenyl)furan-2-ylidene]propanedinitrile;5,8-diethyldodecan-6-amine (PubChem CID 173170969) has the molecular formula C34H48N4O and a molecular weight of 528.79 g/mol. Its IUPAC name is 2-[3-cyano-5,5-dimethyl-4-(2-phenylethenyl)furan-2-ylidene]propanedinitrile;5,8-diethyldodecan-6-amine.
| Compound Name | 2-[3-cyano-5,5-dimethyl-4-(2-phenylethenyl)furan-2-ylidene]propanedinitrile;5,8-diethyldodecan-6-amine |
|---|---|
| PubChem CID | 173170969 |
| Molecular Formula | C34H48N4O |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 2-[3-cyano-5,5-dimethyl-4-(2-phenylethenyl)furan-2-ylidene]propanedinitrile;5,8-diethyldodecan-6-amine |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1C=Cc1ccccc1.CCCCC(CC)CC(N)C(CC)CCCC |
| InChI | InChI=1S/C18H13N3O.C16H35N/c1-18(2)16(9-8-13-6-4-3-5-7-13)15(12-21)17(22-18)14(10-19)11-20;1-5-9-11-14(7-3)13-16(17)15(8-4)12-10-6-2/h3-9H,1-2H3;14-16H,5-13,17H2,1-4H3 |
| InChIKey | NTWWLDICDBZRKQ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|