C18H12N4O3 — CID 11045821
2-[3-cyano-5,5-dimethyl-4-[(E)-2-(3-nitrophenyl)ethenyl]furan-2-ylidene]propanedinitrile (PubChem CID 11045821) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(3-nitrophenyl)ethenyl]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(3-nitrophenyl)ethenyl]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11045821 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[3-cyano-5,5-dimethyl-4-[(E)-2-(3-nitrophenyl)ethenyl]furan-2-ylidene]propanedinitrile |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12N4O3/c1-18(2)16(15(11-21)17(25-18)13(9-19)10-20)7-6-12-4-3-5-14(8-12)22(23)24/h3-8H,1-2H3/b7-6+ |
| InChIKey | QUVISNWRWRYUML-VOTSOKGWSA-N |
| XLogP | 3.54 |
| TPSA | 123.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|