C19H13N5O — CID 122546990
2-[3-cyano-4-[(E)-2-(1H-indazol-7-yl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 122546990) has the molecular formula C19H13N5O and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-[3-cyano-4-[(E)-2-(1H-indazol-7-yl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(E)-2-(1H-indazol-7-yl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 122546990 |
| Molecular Formula | C19H13N5O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[3-cyano-4-[(E)-2-(1H-indazol-7-yl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1/C=C/c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C19H13N5O/c1-19(2)16(15(10-22)18(25-19)14(8-20)9-21)7-6-12-4-3-5-13-11-23-24-17(12)13/h3-7,11H,1-2H3,(H,23,24)/b7-6+ |
| InChIKey | LOCCTICHXDOJHO-VOTSOKGWSA-N |
| XLogP | 3.51 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|