C19H15N3O2 — CID 132603037
2-[3-cyano-4-[(E)-2-(4-methoxyphenyl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 132603037) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[3-cyano-4-[(E)-2-(4-methoxyphenyl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(E)-2-(4-methoxyphenyl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 132603037 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[3-cyano-4-[(E)-2-(4-methoxyphenyl)ethenyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | COc1ccc(/C=C/C2=C(C#N)C(=C(C#N)C#N)OC2(C)C)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-19(2)17(9-6-13-4-7-15(23-3)8-5-13)16(12-22)18(24-19)14(10-20)11-21/h4-9H,1-3H3/b9-6+ |
| InChIKey | KJTVEKKHVQXJHY-RMKNXTFCSA-N |
| XLogP | 3.64 |
| TPSA | 89.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|