C19H16N4O2 — CID 102599340
2-[(4-cyano-2,2-dimethyl-5-oxofuran-3-yl)-[4-(dimethylamino)phenyl]methylidene]propanedinitrile (PubChem CID 102599340) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[(4-cyano-2,2-dimethyl-5-oxofuran-3-yl)-[4-(dimethylamino)phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[(4-cyano-2,2-dimethyl-5-oxofuran-3-yl)-[4-(dimethylamino)phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102599340 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[(4-cyano-2,2-dimethyl-5-oxofuran-3-yl)-[4-(dimethylamino)phenyl]methylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C(=C(C#N)C#N)C2=C(C#N)C(=O)OC2(C)C)cc1 |
| InChI | InChI=1S/C19H16N4O2/c1-19(2)17(15(11-22)18(24)25-19)16(13(9-20)10-21)12-5-7-14(8-6-12)23(3)4/h5-8H,1-4H3 |
| InChIKey | GWWXRKWPIHNLTA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|