About 4-(dimethylamino)benzoyl fluoride;ethane
4-(dimethylamino)benzoyl fluoride;ethane (PubChem CID 90963385) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 4-(dimethylamino)benzoyl fluoride;ethane.
Molecular Properties
| Compound Name | 4-(dimethylamino)benzoyl fluoride;ethane |
| PubChem CID | 90963385 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(dimethylamino)benzoyl fluoride;ethane |
| SMILES | CC.CN(C)c1ccc(C(=O)F)cc1 |
| InChI | InChI=1S/C9H10FNO.C2H6/c1-11(2)8-5-3-7(4-6-8)9(10)12;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | FXVZGDBIGKKSDO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)benzoyl fluoride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)benzoyl fluoride;ethane?
The IUPAC name of 4-(dimethylamino)benzoyl fluoride;ethane (CID 90963385) is 4-(dimethylamino)benzoyl fluoride;ethane.
What is the SMILES notation for 4-(dimethylamino)benzoyl fluoride;ethane?
The canonical SMILES for 4-(dimethylamino)benzoyl fluoride;ethane is CC.CN(C)c1ccc(C(=O)F)cc1.
What is the InChIKey of 4-(dimethylamino)benzoyl fluoride;ethane?
The InChIKey is FXVZGDBIGKKSDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO.C2H6/c1-11(2)8-5-3-7(4-6-8)9(10)12;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of 4-(dimethylamino)benzoyl fluoride;ethane?
4-(dimethylamino)benzoyl fluoride;ethane has a molecular weight of 197.25 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)benzoyl fluoride;ethane is sourced from PubChem (CID 90963385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).