C11H11F2NO2 — CID 71401166
3-[4-(dimethylamino)phenyl]-2,3-difluoroprop-2-enoic acid (PubChem CID 71401166) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2,3-difluoroprop-2-enoic acid.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2,3-difluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 71401166 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2,3-difluoroprop-2-enoic acid |
| SMILES | CN(C)c1ccc(C(F)=C(F)C(=O)O)cc1 |
| InChI | InChI=1S/C11H11F2NO2/c1-14(2)8-5-3-7(4-6-8)9(12)10(13)11(15)16/h3-6H,1-2H3,(H,15,16) |
| InChIKey | NCPBILXMKUJESW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|