C40H20F6Si — CID 25194399
1,2,4,6,8,9-hexafluoro-5,5-diphenyl-3,7-bis(2-phenylethynyl)benzo[b][1]benzosilole (PubChem CID 25194399) has the molecular formula C40H20F6Si and a molecular weight of 642.67 g/mol. Its IUPAC name is 1,2,4,6,8,9-hexafluoro-5,5-diphenyl-3,7-bis(2-phenylethynyl)benzo[b][1]benzosilole.
| Compound Name | 1,2,4,6,8,9-hexafluoro-5,5-diphenyl-3,7-bis(2-phenylethynyl)benzo[b][1]benzosilole |
|---|---|
| PubChem CID | 25194399 |
| Molecular Formula | C40H20F6Si |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | 1,2,4,6,8,9-hexafluoro-5,5-diphenyl-3,7-bis(2-phenylethynyl)benzo[b][1]benzosilole |
| SMILES | Fc1c(F)c2c(c(F)c1C#Cc1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1c(F)c(C#Cc3ccccc3)c(F)c(F)c1-2 |
| InChI | InChI=1S/C40H20F6Si/c41-33-29(23-21-25-13-5-1-6-14-25)35(43)39-31(37(33)45)32-38(46)34(42)30(24-22-26-15-7-2-8-16-26)36(44)40(32)47(39,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20H |
| InChIKey | JJSLQGJLIOQKQL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|