C27H32F4Si3 — CID 101470711
trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-phenylethynyl)phenyl]-3,4-bis(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane (PubChem CID 101470711) has the molecular formula C27H32F4Si3 and a molecular weight of 516.80 g/mol. Its IUPAC name is trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-phenylethynyl)phenyl]-3,4-bis(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane.
| Compound Name | trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-phenylethynyl)phenyl]-3,4-bis(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane |
|---|---|
| PubChem CID | 101470711 |
| Molecular Formula | C27H32F4Si3 |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | trimethyl-[2-[2,3,5,6-tetrafluoro-4-(2-phenylethynyl)phenyl]-3,4-bis(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane |
| SMILES | C[Si](C)(C)C12C3(c4c(F)c(F)c(C#Cc5ccccc5)c(F)c4F)C1([Si](C)(C)C)C32[Si](C)(C)C |
| InChI | InChI=1S/C27H32F4Si3/c1-32(2,3)25-24(26(25,33(4,5)6)27(24,25)34(7,8)9)19-22(30)20(28)18(21(29)23(19)31)16-15-17-13-11-10-12-14-17/h10-14H,1-9H3 |
| InChIKey | YDELJRZPLWHRDU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|