C28H37F5NiP2 — CID 139252905
2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;nickel;1,2,3,4,5-pentafluoro-6-(2-phenylethynyl)benzene (PubChem CID 139252905) has the molecular formula C28H37F5NiP2 and a molecular weight of 589.24 g/mol. Its IUPAC name is 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;nickel;1,2,3,4,5-pentafluoro-6-(2-phenylethynyl)benzene.
| Compound Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;nickel;1,2,3,4,5-pentafluoro-6-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 139252905 |
| Molecular Formula | C28H37F5NiP2 |
| Molecular Weight | 589.24 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 2-di(propan-2-yl)phosphanylethyl-di(propan-2-yl)phosphane;nickel;1,2,3,4,5-pentafluoro-6-(2-phenylethynyl)benzene |
| SMILES | CC(C)P(CCP(C(C)C)C(C)C)C(C)C.Fc1c(F)c(F)c(C#Cc2ccccc2)c(F)c1F.[Ni] |
| InChI | InChI=1S/C14H5F5.C14H32P2.Ni/c15-10-9(7-6-8-4-2-1-3-5-8)11(16)13(18)14(19)12(10)17;1-11(2)15(12(3)4)9-10-16(13(5)6)14(7)8;/h1-5H;11-14H,9-10H2,1-8H3; |
| InChIKey | KLQFUFHXRPDQIO-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.24 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|