C20H10F4 — CID 139846771
6-[2-(4-ethenyl-2,6-difluorophenyl)ethynyl]-1,2-difluoronaphthalene (PubChem CID 139846771) has the molecular formula C20H10F4 and a molecular weight of 326.29 g/mol. Its IUPAC name is 6-[2-(4-ethenyl-2,6-difluorophenyl)ethynyl]-1,2-difluoronaphthalene.
| Compound Name | 6-[2-(4-ethenyl-2,6-difluorophenyl)ethynyl]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139846771 |
| Molecular Formula | C20H10F4 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 6-[2-(4-ethenyl-2,6-difluorophenyl)ethynyl]-1,2-difluoronaphthalene |
| SMILES | C=Cc1cc(F)c(C#Cc2ccc3c(F)c(F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H10F4/c1-2-12-10-18(22)16(19(23)11-12)7-4-13-3-6-15-14(9-13)5-8-17(21)20(15)24/h2-3,5-6,8-11H,1H2 |
| InChIKey | WMEOKFLRWKNPKS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|