C17H10F4O — CID 71402760
2-[2-[4-(difluoromethoxy)phenyl]ethynyl]-5-ethenyl-1,3-difluorobenzene (PubChem CID 71402760) has the molecular formula C17H10F4O and a molecular weight of 306.26 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethynyl]-5-ethenyl-1,3-difluorobenzene.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethynyl]-5-ethenyl-1,3-difluorobenzene |
|---|---|
| PubChem CID | 71402760 |
| Molecular Formula | C17H10F4O |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethynyl]-5-ethenyl-1,3-difluorobenzene |
| SMILES | C=Cc1cc(F)c(C#Cc2ccc(OC(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C17H10F4O/c1-2-11-9-15(18)14(16(19)10-11)8-5-12-3-6-13(7-4-12)22-17(20)21/h2-4,6-7,9-10,17H,1H2 |
| InChIKey | BLUPQMULZROHOI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|