C20H18F2O — CID 59790322
1-(difluoromethoxy)-4-[2-(3-pent-4-enylphenyl)ethynyl]benzene (PubChem CID 59790322) has the molecular formula C20H18F2O and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[2-(3-pent-4-enylphenyl)ethynyl]benzene.
| Compound Name | 1-(difluoromethoxy)-4-[2-(3-pent-4-enylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 59790322 |
| Molecular Formula | C20H18F2O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(difluoromethoxy)-4-[2-(3-pent-4-enylphenyl)ethynyl]benzene |
| SMILES | C=CCCCc1cccc(C#Cc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H18F2O/c1-2-3-4-6-17-7-5-8-18(15-17)10-9-16-11-13-19(14-12-16)23-20(21)22/h2,5,7-8,11-15,20H,1,3-4,6H2 |
| InChIKey | YDWYLMHHXBDJHS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|