C23H27F2N3O — CID 68735881
5-[4-(difluoromethoxy)phenyl]-5-(3-hex-5-enylphenyl)-3-methyl-4H-imidazol-2-amine (PubChem CID 68735881) has the molecular formula C23H27F2N3O and a molecular weight of 399.49 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-5-(3-hex-5-enylphenyl)-3-methyl-4H-imidazol-2-amine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-5-(3-hex-5-enylphenyl)-3-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 68735881 |
| Molecular Formula | C23H27F2N3O |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-5-(3-hex-5-enylphenyl)-3-methyl-4H-imidazol-2-amine |
| SMILES | C=CCCCCc1cccc(C2(c3ccc(OC(F)F)cc3)CN(C)C(N)=N2)c1 |
| InChI | InChI=1S/C23H27F2N3O/c1-3-4-5-6-8-17-9-7-10-19(15-17)23(16-28(2)22(26)27-23)18-11-13-20(14-12-18)29-21(24)25/h3,7,9-15,21H,1,4-6,8,16H2,2H3,(H2,26,27) |
| InChIKey | LFBYBGJCTXBFPD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|