C21H24F3N3O — CID 141167351
5-[4-(difluoromethoxy)phenyl]-5-[3-(4-fluorobutyl)phenyl]-3-methyl-4H-imidazol-2-amine (PubChem CID 141167351) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-5-[3-(4-fluorobutyl)phenyl]-3-methyl-4H-imidazol-2-amine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-5-[3-(4-fluorobutyl)phenyl]-3-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141167351 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-5-[3-(4-fluorobutyl)phenyl]-3-methyl-4H-imidazol-2-amine |
| SMILES | CN1CC(c2ccc(OC(F)F)cc2)(c2cccc(CCCCF)c2)N=C1N |
| InChI | InChI=1S/C21H24F3N3O/c1-27-14-21(26-20(27)25,16-8-10-18(11-9-16)28-19(23)24)17-7-4-6-15(13-17)5-2-3-12-22/h4,6-11,13,19H,2-3,5,12,14H2,1H3,(H2,25,26) |
| InChIKey | UDJMITPORTWGAL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|