C23H28F3N3O — CID 141167360
5-[4-(difluoromethoxy)phenyl]-5-[3-(6-fluorohexyl)phenyl]-3-methyl-4H-imidazol-2-amine (PubChem CID 141167360) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-5-[3-(6-fluorohexyl)phenyl]-3-methyl-4H-imidazol-2-amine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-5-[3-(6-fluorohexyl)phenyl]-3-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141167360 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-5-[3-(6-fluorohexyl)phenyl]-3-methyl-4H-imidazol-2-amine |
| SMILES | CN1CC(c2ccc(OC(F)F)cc2)(c2cccc(CCCCCCF)c2)N=C1N |
| InChI | InChI=1S/C23H28F3N3O/c1-29-16-23(28-22(29)27,18-10-12-20(13-11-18)30-21(25)26)19-9-6-8-17(15-19)7-4-2-3-5-14-24/h6,8-13,15,21H,2-5,7,14,16H2,1H3,(H2,27,28) |
| InChIKey | XZDWPDYCUPCHCI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|