C19H20F3N3O — CID 141215323
5-[4-(difluoromethoxy)-3-(2-fluoroethyl)phenyl]-3-methyl-5-phenyl-4H-imidazol-2-amine (PubChem CID 141215323) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)-3-(2-fluoroethyl)phenyl]-3-methyl-5-phenyl-4H-imidazol-2-amine.
| Compound Name | 5-[4-(difluoromethoxy)-3-(2-fluoroethyl)phenyl]-3-methyl-5-phenyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141215323 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 5-[4-(difluoromethoxy)-3-(2-fluoroethyl)phenyl]-3-methyl-5-phenyl-4H-imidazol-2-amine |
| SMILES | CN1CC(c2ccccc2)(c2ccc(OC(F)F)c(CCF)c2)N=C1N |
| InChI | InChI=1S/C19H20F3N3O/c1-25-12-19(24-18(25)23,14-5-3-2-4-6-14)15-7-8-16(26-17(21)22)13(11-15)9-10-20/h2-8,11,17H,9-10,12H2,1H3,(H2,23,24) |
| InChIKey | GOXYMWJZCJBPIC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |