C23H22F2N4O — CID 141217605
5-(3-anilinophenyl)-5-[4-(difluoromethoxy)phenyl]-3-methyl-4H-imidazol-2-amine (PubChem CID 141217605) has the molecular formula C23H22F2N4O and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-(3-anilinophenyl)-5-[4-(difluoromethoxy)phenyl]-3-methyl-4H-imidazol-2-amine.
| Compound Name | 5-(3-anilinophenyl)-5-[4-(difluoromethoxy)phenyl]-3-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141217605 |
| Molecular Formula | C23H22F2N4O |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-(3-anilinophenyl)-5-[4-(difluoromethoxy)phenyl]-3-methyl-4H-imidazol-2-amine |
| SMILES | CN1CC(c2ccc(OC(F)F)cc2)(c2cccc(Nc3ccccc3)c2)N=C1N |
| InChI | InChI=1S/C23H22F2N4O/c1-29-15-23(28-22(29)26,16-10-12-20(13-11-16)30-21(24)25)17-6-5-9-19(14-17)27-18-7-3-2-4-8-18/h2-14,21,27H,15H2,1H3,(H2,26,28) |
| InChIKey | CVJVWQTWUURZRZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |