C18H17F2NO — CID 70822444
3-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]propan-1-amine (PubChem CID 70822444) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is 3-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 70822444 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(C#Cc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C18H17F2NO/c19-18(20)22-17-10-8-14(9-11-17)6-7-16-4-1-3-15(13-16)5-2-12-21/h1,3-4,8-11,13,18H,2,5,12,21H2 |
| InChIKey | LBATUFHYRDGQKB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|