C30H20F4O6 — CID 159228799
3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenol;1-[4-(difluoromethoxy)phenyl]-2-(3-hydroxyphenyl)ethane-1,2-dione (PubChem CID 159228799) has the molecular formula C30H20F4O6 and a molecular weight of 552.48 g/mol. Its IUPAC name is 3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenol;1-[4-(difluoromethoxy)phenyl]-2-(3-hydroxyphenyl)ethane-1,2-dione.
| Compound Name | 3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenol;1-[4-(difluoromethoxy)phenyl]-2-(3-hydroxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 159228799 |
| Molecular Formula | C30H20F4O6 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenol;1-[4-(difluoromethoxy)phenyl]-2-(3-hydroxyphenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc(O)c1)c1ccc(OC(F)F)cc1.Oc1cccc(C#Cc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C15H10F2O4.C15H10F2O2/c16-15(17)21-12-6-4-9(5-7-12)13(19)14(20)10-2-1-3-11(18)8-10;16-15(17)19-14-8-6-11(7-9-14)4-5-12-2-1-3-13(18)10-12/h1-8,15,18H;1-3,6-10,15,18H |
| InChIKey | KSQAOUYXSVQIMW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|