C42H30F4N2O4 — CID 161144500
1-(3-anilinophenyl)-2-[4-(difluoromethoxy)phenyl]ethane-1,2-dione;3-[2-[4-(difluoromethoxy)phenyl]ethynyl]-N-phenylaniline (PubChem CID 161144500) has the molecular formula C42H30F4N2O4 and a molecular weight of 702.70 g/mol. Its IUPAC name is 1-(3-anilinophenyl)-2-[4-(difluoromethoxy)phenyl]ethane-1,2-dione;3-[2-[4-(difluoromethoxy)phenyl]ethynyl]-N-phenylaniline.
| Compound Name | 1-(3-anilinophenyl)-2-[4-(difluoromethoxy)phenyl]ethane-1,2-dione;3-[2-[4-(difluoromethoxy)phenyl]ethynyl]-N-phenylaniline |
|---|---|
| PubChem CID | 161144500 |
| Molecular Formula | C42H30F4N2O4 |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | 1-(3-anilinophenyl)-2-[4-(difluoromethoxy)phenyl]ethane-1,2-dione;3-[2-[4-(difluoromethoxy)phenyl]ethynyl]-N-phenylaniline |
| SMILES | FC(F)Oc1ccc(C#Cc2cccc(Nc3ccccc3)c2)cc1.O=C(C(=O)c1cccc(Nc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H15F2NO3.C21H15F2NO/c22-21(23)27-18-11-9-14(10-12-18)19(25)20(26)15-5-4-8-17(13-15)24-16-6-2-1-3-7-16;22-21(23)25-20-13-11-16(12-14-20)9-10-17-5-4-8-19(15-17)24-18-6-2-1-3-7-18/h1-13,21,24H;1-8,11-15,21,24H |
| InChIKey | UNWGECFXGMJMGS-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|