C17H15F2NO3S — CID 59790328
N-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]ethanesulfonamide (PubChem CID 59790328) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]ethanesulfonamide.
| Compound Name | N-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59790328 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(C#Cc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F2NO3S/c1-2-24(21,22)20-15-5-3-4-14(12-15)7-6-13-8-10-16(11-9-13)23-17(18)19/h3-5,8-12,17,20H,2H2,1H3 |
| InChIKey | RQZWLTPIMXZNCX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|