C20H20F3O3P — CID 67537407
[[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]-fluoromethyl]-diethoxyphosphane (PubChem CID 67537407) has the molecular formula C20H20F3O3P and a molecular weight of 396.35 g/mol. Its IUPAC name is [[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]-fluoromethyl]-diethoxyphosphane.
| Compound Name | [[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]-fluoromethyl]-diethoxyphosphane |
|---|---|
| PubChem CID | 67537407 |
| Molecular Formula | C20H20F3O3P |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [[3-[2-[4-(difluoromethoxy)phenyl]ethynyl]phenyl]-fluoromethyl]-diethoxyphosphane |
| SMILES | CCOP(OCC)C(F)c1cccc(C#Cc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H20F3O3P/c1-3-24-27(25-4-2)19(21)17-7-5-6-16(14-17)9-8-15-10-12-18(13-11-15)26-20(22)23/h5-7,10-14,19-20H,3-4H2,1-2H3 |
| InChIKey | ZBHQKRFTQBBNDU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|