C16H8F4 — CID 71402744
2-[2-(3,4-difluorophenyl)ethynyl]-5-ethenyl-1,3-difluorobenzene (PubChem CID 71402744) has the molecular formula C16H8F4 and a molecular weight of 276.23 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)ethynyl]-5-ethenyl-1,3-difluorobenzene.
| Compound Name | 2-[2-(3,4-difluorophenyl)ethynyl]-5-ethenyl-1,3-difluorobenzene |
|---|---|
| PubChem CID | 71402744 |
| Molecular Formula | C16H8F4 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)ethynyl]-5-ethenyl-1,3-difluorobenzene |
| SMILES | C=Cc1cc(F)c(C#Cc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C16H8F4/c1-2-10-7-14(18)12(15(19)8-10)5-3-11-4-6-13(17)16(20)9-11/h2,4,6-9H,1H2 |
| InChIKey | BMQXKNQWECNANJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|