C9H4F4 — CID 172724217
4-(3,3-difluoroprop-1-ynyl)-1,2-difluorobenzene (PubChem CID 172724217) has the molecular formula C9H4F4 and a molecular weight of 188.12 g/mol. Its IUPAC name is 4-(3,3-difluoroprop-1-ynyl)-1,2-difluorobenzene.
| Compound Name | 4-(3,3-difluoroprop-1-ynyl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 172724217 |
| Molecular Formula | C9H4F4 |
| Molecular Weight | 188.12 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 4-(3,3-difluoroprop-1-ynyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(C#CC(F)F)cc1F |
| InChI | InChI=1S/C9H4F4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,9H |
| InChIKey | GXQQDLCDZSFOMG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|