C23H32F2O5 — CID 126625965
(8S,9S,11S)-16-(3,4-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-15-ynoic acid (PubChem CID 126625965) has the molecular formula C23H32F2O5 and a molecular weight of 426.50 g/mol. Its IUPAC name is (8S,9S,11S)-16-(3,4-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-15-ynoic acid.
| Compound Name | (8S,9S,11S)-16-(3,4-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-15-ynoic acid |
|---|---|
| PubChem CID | 126625965 |
| Molecular Formula | C23H32F2O5 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (8S,9S,11S)-16-(3,4-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-15-ynoic acid |
| SMILES | C[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@@H](O)CCC(O)C#Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H32F2O5/c1-16(6-4-2-3-5-7-23(29)30)22(28)15-19(27)12-11-18(26)10-8-17-9-13-20(24)21(25)14-17/h9,13-14,16,18-19,22,26-28H,2-7,11-12,15H2,1H3,(H,29,30)/t16-,18?,19-,22-/m0/s1 |
| InChIKey | GVOKFBANOUYRKT-RJUGYJNNSA-N |
| XLogP | 3.63 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|