C23H30F2O5 — CID 163642657
(Z,8S,9S)-16-(3,5-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-11-en-15-ynoic acid (PubChem CID 163642657) has the molecular formula C23H30F2O5 and a molecular weight of 424.48 g/mol. Its IUPAC name is (Z,8S,9S)-16-(3,5-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-11-en-15-ynoic acid.
| Compound Name | (Z,8S,9S)-16-(3,5-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-11-en-15-ynoic acid |
|---|---|
| PubChem CID | 163642657 |
| Molecular Formula | C23H30F2O5 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (Z,8S,9S)-16-(3,5-difluorophenyl)-9,11,14-trihydroxy-8-methylhexadec-11-en-15-ynoic acid |
| SMILES | C[C@@H](CCCCCCC(=O)O)[C@@H](O)C/C(O)=C/CC(O)C#Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H30F2O5/c1-16(6-4-2-3-5-7-23(29)30)22(28)15-21(27)11-10-20(26)9-8-17-12-18(24)14-19(25)13-17/h11-14,16,20,22,26-28H,2-7,10,15H2,1H3,(H,29,30)/b21-11-/t16-,20?,22-/m0/s1 |
| InChIKey | IFOSBZDJJGJSAA-QSUDNNGUSA-N |
| XLogP | 4.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|