C11H11F2N — CID 63997889
4-(3,4-difluorophenyl)-2-methylbut-3-yn-2-amine (PubChem CID 63997889) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-methylbut-3-yn-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-2-methylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 63997889 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-methylbut-3-yn-2-amine |
| SMILES | CC(C)(N)C#Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2N/c1-11(2,14)6-5-8-3-4-9(12)10(13)7-8/h3-4,7H,14H2,1-2H3 |
| InChIKey | VXPCOSLPSAUXOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|