C25H18F4O2 — CID 139857340
2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-prop-2-enyl-1,3-dioxane (PubChem CID 139857340) has the molecular formula C25H18F4O2 and a molecular weight of 426.41 g/mol. Its IUPAC name is 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-prop-2-enyl-1,3-dioxane.
| Compound Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 139857340 |
| Molecular Formula | C25H18F4O2 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[4-[2-(5,6-difluoronaphthalen-2-yl)ethynyl]-3,5-difluorophenyl]-5-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1COC(c2cc(F)c(C#Cc3ccc4c(F)c(F)ccc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C25H18F4O2/c1-2-3-16-13-30-25(31-14-16)18-11-22(27)20(23(28)12-18)8-5-15-4-7-19-17(10-15)6-9-21(26)24(19)29/h2,4,6-7,9-12,16,25H,1,3,13-14H2 |
| InChIKey | WTJKVDGLXVNSSZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|