C18H24F6O2 — CID 153282501
1,4-bis(2,2-difluoro-3,3-dimethylbutoxy)-2,3-difluorobenzene (PubChem CID 153282501) has the molecular formula C18H24F6O2 and a molecular weight of 386.38 g/mol. Its IUPAC name is 1,4-bis(2,2-difluoro-3,3-dimethylbutoxy)-2,3-difluorobenzene.
| Compound Name | 1,4-bis(2,2-difluoro-3,3-dimethylbutoxy)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282501 |
| Molecular Formula | C18H24F6O2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1,4-bis(2,2-difluoro-3,3-dimethylbutoxy)-2,3-difluorobenzene |
| SMILES | CC(C)(C)C(F)(F)COc1ccc(OCC(F)(F)C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C18H24F6O2/c1-15(2,3)17(21,22)9-25-11-7-8-12(14(20)13(11)19)26-10-18(23,24)16(4,5)6/h7-8H,9-10H2,1-6H3 |
| InChIKey | VNXLQDBRQQNGNZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |