C21H28F2O — CID 76631780
1-(4-but-1-enylcyclohexen-1-yl)-2,3-difluoro-4-pentoxybenzene (PubChem CID 76631780) has the molecular formula C21H28F2O and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-(4-but-1-enylcyclohexen-1-yl)-2,3-difluoro-4-pentoxybenzene.
| Compound Name | 1-(4-but-1-enylcyclohexen-1-yl)-2,3-difluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 76631780 |
| Molecular Formula | C21H28F2O |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-(4-but-1-enylcyclohexen-1-yl)-2,3-difluoro-4-pentoxybenzene |
| SMILES | CCC=CC1CC=C(c2ccc(OCCCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H28F2O/c1-3-5-7-15-24-19-14-13-18(20(22)21(19)23)17-11-9-16(10-12-17)8-6-4-2/h6,8,11,13-14,16H,3-5,7,9-10,12,15H2,1-2H3 |
| InChIKey | SAPKBZOQJMZWPK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|