C17H21NO2 — CID 142251345
3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)benzonitrile;ethane (PubChem CID 142251345) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)benzonitrile;ethane.
| Compound Name | 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)benzonitrile;ethane |
|---|---|
| PubChem CID | 142251345 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)benzonitrile;ethane |
| SMILES | CC.N#Cc1cccc(C2=CCC3(CC2)OCCO3)c1 |
| InChI | InChI=1S/C15H15NO2.C2H6/c16-11-12-2-1-3-14(10-12)13-4-6-15(7-5-13)17-8-9-18-15;1-2/h1-4,10H,5-9H2;1-2H3 |
| InChIKey | KYQHXZGOXDLQCT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |