About 3-cyclohexa-1,3-dien-1-ylbenzonitrile
3-cyclohexa-1,3-dien-1-ylbenzonitrile (PubChem CID 51032200) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-ylbenzonitrile.
Molecular Properties
| Compound Name | 3-cyclohexa-1,3-dien-1-ylbenzonitrile |
| PubChem CID | 51032200 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-ylbenzonitrile |
| SMILES | N#Cc1cccc(C2=CC=CCC2)c1 |
| InChI | InChI=1S/C13H11N/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-2,4-6,8-9H,3,7H2 |
| InChIKey | VVBICEMQXYNUTD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexa-1,3-dien-1-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,3-dien-1-ylbenzonitrile?
The IUPAC name of 3-cyclohexa-1,3-dien-1-ylbenzonitrile (CID 51032200) is 3-cyclohexa-1,3-dien-1-ylbenzonitrile.
What is the SMILES notation for 3-cyclohexa-1,3-dien-1-ylbenzonitrile?
The canonical SMILES for 3-cyclohexa-1,3-dien-1-ylbenzonitrile is N#Cc1cccc(C2=CC=CCC2)c1.
What is the InChIKey of 3-cyclohexa-1,3-dien-1-ylbenzonitrile?
The InChIKey is VVBICEMQXYNUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-2,4-6,8-9H,3,7H2.
What are the key properties of 3-cyclohexa-1,3-dien-1-ylbenzonitrile?
3-cyclohexa-1,3-dien-1-ylbenzonitrile has a molecular weight of 181.24 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,3-dien-1-ylbenzonitrile is sourced from PubChem (CID 51032200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).