C12H13N3O — CID 144584571
ethane;3-(5-methyl-1,3,4-oxadiazol-2-yl)benzonitrile (PubChem CID 144584571) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is ethane;3-(5-methyl-1,3,4-oxadiazol-2-yl)benzonitrile.
| Compound Name | ethane;3-(5-methyl-1,3,4-oxadiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 144584571 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | ethane;3-(5-methyl-1,3,4-oxadiazol-2-yl)benzonitrile |
| SMILES | CC.Cc1nnc(-c2cccc(C#N)c2)o1 |
| InChI | InChI=1S/C10H7N3O.C2H6/c1-7-12-13-10(14-7)9-4-2-3-8(5-9)6-11;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | NYGCUYVXVLKPIC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |