C13H14N2O — CID 161302444
methane;2-methyl-5-(3-prop-1-ynylphenyl)-1,3,4-oxadiazole (PubChem CID 161302444) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is methane;2-methyl-5-(3-prop-1-ynylphenyl)-1,3,4-oxadiazole.
| Compound Name | methane;2-methyl-5-(3-prop-1-ynylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 161302444 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | methane;2-methyl-5-(3-prop-1-ynylphenyl)-1,3,4-oxadiazole |
| SMILES | C.CC#Cc1cccc(-c2nnc(C)o2)c1 |
| InChI | InChI=1S/C12H10N2O.CH4/c1-3-5-10-6-4-7-11(8-10)12-14-13-9(2)15-12;/h4,6-8H,1-2H3;1H4 |
| InChIKey | VHULQOWSRVDBCE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|