About 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile
3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile (PubChem CID 24776451) has the molecular formula C14H8N4O
and a molecular weight of 248.25 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile |
| PubChem CID | 24776451 |
| Molecular Formula | C14H8N4O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nnc(-c3cccnc3)o2)c1 |
| InChI | InChI=1S/C14H8N4O/c15-8-10-3-1-4-11(7-10)13-17-18-14(19-13)12-5-2-6-16-9-12/h1-7,9H |
| InChIKey | QHPFKJSSVIVVDV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile?
The IUPAC name of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile (CID 24776451) is 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile.
What is the SMILES notation for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile?
The canonical SMILES for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile is N#Cc1cccc(-c2nnc(-c3cccnc3)o2)c1.
What is the InChIKey of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile?
The InChIKey is QHPFKJSSVIVVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O/c15-8-10-3-1-4-11(7-10)13-17-18-14(19-13)12-5-2-6-16-9-12/h1-7,9H.
What are the key properties of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile?
3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile has a molecular weight of 248.25 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)benzonitrile is sourced from PubChem (CID 24776451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).