C15H19F — CID 83931656
1-fluoro-4,5-dimethyl-2-(2-methylhex-3-ynyl)benzene (PubChem CID 83931656) has the molecular formula C15H19F and a molecular weight of 218.31 g/mol. Its IUPAC name is 1-fluoro-4,5-dimethyl-2-(2-methylhex-3-ynyl)benzene.
| Compound Name | 1-fluoro-4,5-dimethyl-2-(2-methylhex-3-ynyl)benzene |
|---|---|
| PubChem CID | 83931656 |
| Molecular Formula | C15H19F |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-fluoro-4,5-dimethyl-2-(2-methylhex-3-ynyl)benzene |
| SMILES | CCC#CC(C)Cc1cc(C)c(C)cc1F |
| InChI | InChI=1S/C15H19F/c1-5-6-7-11(2)8-14-9-12(3)13(4)10-15(14)16/h9-11H,5,8H2,1-4H3 |
| InChIKey | ORDKLHGDGNWVQM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|